C19H29N5S — CID 19342891
1-[3-(diethylamino)propyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19342891) has the molecular formula C19H29N5S and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342891 |
| Molecular Formula | C19H29N5S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1cnn(Cc2ccccc2C)c1 |
| InChI | InChI=1S/C19H29N5S/c1-4-23(5-2)12-8-11-20-19(25)22-18-13-21-24(15-18)14-17-10-7-6-9-16(17)3/h6-7,9-10,13,15H,4-5,8,11-12,14H2,1-3H3,(H2,20,22,25) |
| InChIKey | SYCVZSQNOARIRX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|