C16H17FN6OS — CID 19445671
1-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19445671) has the molecular formula C16H17FN6OS and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445671 |
| Molecular Formula | C16H17FN6OS |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-3-[1-(methoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | COCn1cc(NC(=S)Nc2cnn(Cc3ccc(F)cc3)c2)cn1 |
| InChI | InChI=1S/C16H17FN6OS/c1-24-11-23-10-15(7-19-23)21-16(25)20-14-6-18-22(9-14)8-12-2-4-13(17)5-3-12/h2-7,9-10H,8,11H2,1H3,(H2,20,21,25) |
| InChIKey | ATQHAHGBLYWLTE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|