C15H19FN4OS — CID 19344076
1-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3-(3-methoxypropyl)thiourea (PubChem CID 19344076) has the molecular formula C15H19FN4OS and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 19344076 |
| Molecular Formula | C15H19FN4OS |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)Nc1cnn(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H19FN4OS/c1-21-7-3-6-17-15(22)19-14-9-18-20(11-14)10-12-4-2-5-13(16)8-12/h2,4-5,8-9,11H,3,6-7,10H2,1H3,(H2,17,19,22) |
| InChIKey | HQUABCIOCIZIMN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|