C15H19FN4S — CID 51391449
1-[(2S)-butan-2-yl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 51391449) has the molecular formula C15H19FN4S and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[(2S)-butan-2-yl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 51391449 |
| Molecular Formula | C15H19FN4S |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CC[C@H](C)NC(=S)Nc1cnn(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H19FN4S/c1-3-11(2)18-15(21)19-14-8-17-20(10-14)9-12-5-4-6-13(16)7-12/h4-8,10-11H,3,9H2,1-2H3,(H2,18,19,21)/t11-/m0/s1 |
| InChIKey | OPJMASVLQWILRL-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|