C17H21FN4S — CID 3461195
1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 3461195) has the molecular formula C17H21FN4S and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 3461195 |
| Molecular Formula | C17H21FN4S |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Fc1cccc(Cn2cc(NC(=S)NC3CCCCC3)cn2)c1 |
| InChI | InChI=1S/C17H21FN4S/c18-14-6-4-5-13(9-14)11-22-12-16(10-19-22)21-17(23)20-15-7-2-1-3-8-15/h4-6,9-10,12,15H,1-3,7-8,11H2,(H2,20,21,23) |
| InChIKey | UJSSBSXHANUSMH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|