C17H13ClF2N4S — CID 19344082
1-(3-chloro-4-fluorophenyl)-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19344082) has the molecular formula C17H13ClF2N4S and a molecular weight of 378.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344082 |
| Molecular Formula | C17H13ClF2N4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Fc1cccc(Cn2cc(NC(=S)Nc3ccc(F)c(Cl)c3)cn2)c1 |
| InChI | InChI=1S/C17H13ClF2N4S/c18-15-7-13(4-5-16(15)20)22-17(25)23-14-8-21-24(10-14)9-11-2-1-3-12(19)6-11/h1-8,10H,9H2,(H2,22,23,25) |
| InChIKey | VHVQUZCMDIRJBT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|