C21H15ClF4N6S — CID 19343653
1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19343653) has the molecular formula C21H15ClF4N6S and a molecular weight of 494.91 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343653 |
| Molecular Formula | C21H15ClF4N6S |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Fc1cc(F)c(Cn2cc(NC(=S)Nc3cnn(Cc4cccc(Cl)c4)c3)cn2)c(F)c1F |
| InChI | InChI=1S/C21H15ClF4N6S/c22-13-3-1-2-12(4-13)8-31-9-14(6-27-31)29-21(33)30-15-7-28-32(10-15)11-16-17(23)5-18(24)20(26)19(16)25/h1-7,9-10H,8,11H2,(H2,29,30,33) |
| InChIKey | XTKUPPZRFLINOH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|