C23H23ClN6OS — CID 19344804
1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea (PubChem CID 19344804) has the molecular formula C23H23ClN6OS and a molecular weight of 467.00 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344804 |
| Molecular Formula | C23H23ClN6OS |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCc1ccc(OCn2cc(NC(=S)Nc3cnn(Cc4cccc(Cl)c4)c3)cn2)cc1 |
| InChI | InChI=1S/C23H23ClN6OS/c1-2-17-6-8-22(9-7-17)31-16-30-15-21(12-26-30)28-23(32)27-20-11-25-29(14-20)13-18-4-3-5-19(24)10-18/h3-12,14-15H,2,13,16H2,1H3,(H2,27,28,32) |
| InChIKey | ZEAUQPBJBIAHLV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|