C16H22ClN5OS — CID 19344912
1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-[3-(dimethylamino)propyl]thiourea (PubChem CID 19344912) has the molecular formula C16H22ClN5OS and a molecular weight of 367.91 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-[3-(dimethylamino)propyl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-[3-(dimethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 19344912 |
| Molecular Formula | C16H22ClN5OS |
| Molecular Weight | 367.91 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-[3-(dimethylamino)propyl]thiourea |
| SMILES | CN(C)CCCNC(=S)Nc1cnn(COc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H22ClN5OS/c1-21(2)8-4-7-18-16(24)20-14-10-19-22(11-14)12-23-15-6-3-5-13(17)9-15/h3,5-6,9-11H,4,7-8,12H2,1-2H3,(H2,18,20,24) |
| InChIKey | SWIQBSQSCQQUHI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.91 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|