C21H17BrCl2N6OS — CID 19445526
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445526) has the molecular formula C21H17BrCl2N6OS and a molecular weight of 552.29 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445526 |
| Molecular Formula | C21H17BrCl2N6OS |
| Molecular Weight | 552.29 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]thiourea |
| SMILES | S=C(Nc1cnn(COc2cccc(Cl)c2)c1)Nc1nn(Cc2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C21H17BrCl2N6OS/c22-18-12-29(10-14-4-1-2-7-19(14)24)28-20(18)27-21(32)26-16-9-25-30(11-16)13-31-17-6-3-5-15(23)8-17/h1-9,11-12H,10,13H2,(H2,26,27,28,32) |
| InChIKey | JZAAUCSGYQZCDH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.29 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|