C17H14BrClN4OS — CID 19445555
1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3-chlorophenyl)thiourea (PubChem CID 19445555) has the molecular formula C17H14BrClN4OS and a molecular weight of 437.75 g/mol. Its IUPAC name is 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 19445555 |
| Molecular Formula | C17H14BrClN4OS |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3-chlorophenyl)thiourea |
| SMILES | S=C(Nc1cccc(Cl)c1)Nc1cnn(COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H14BrClN4OS/c18-12-4-6-16(7-5-12)24-11-23-10-15(9-20-23)22-17(25)21-14-3-1-2-13(19)8-14/h1-10H,11H2,(H2,21,22,25) |
| InChIKey | LEVFFZGQZKLZKR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|