C23H27BrN4O3S — CID 19445560
1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea (PubChem CID 19445560) has the molecular formula C23H27BrN4O3S and a molecular weight of 519.47 g/mol. Its IUPAC name is 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19445560 |
| Molecular Formula | C23H27BrN4O3S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[2-(3,4-diethoxyphenyl)ethyl]thiourea |
| SMILES | CCOc1ccc(CCNC(=S)Nc2cnn(COc3ccc(Br)cc3)c2)cc1OCC |
| InChI | InChI=1S/C23H27BrN4O3S/c1-3-29-21-10-5-17(13-22(21)30-4-2)11-12-25-23(32)27-19-14-26-28(15-19)16-31-20-8-6-18(24)7-9-20/h5-10,13-15H,3-4,11-12,16H2,1-2H3,(H2,25,27,32) |
| InChIKey | DSIMIBHLMVJTRK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|