C23H28N4O2S — CID 19344201
1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 19344201) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 19344201 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | CCOc1ccc(Cn2cc(NC(=S)Nc3cc(C)ccc3C)cn2)cc1OCC |
| InChI | InChI=1S/C23H28N4O2S/c1-5-28-21-10-9-18(12-22(21)29-6-2)14-27-15-19(13-24-27)25-23(30)26-20-11-16(3)7-8-17(20)4/h7-13,15H,5-6,14H2,1-4H3,(H2,25,26,30) |
| InChIKey | IIXHIHIVZDZRAO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|