C21H28N6O2S — CID 19344221
1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19344221) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19344221 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
| SMILES | CCOc1ccc(Cn2cc(NC(=S)NCc3cnn(CC)c3)cn2)cc1OCC |
| InChI | InChI=1S/C21H28N6O2S/c1-4-26-14-17(11-23-26)10-22-21(30)25-18-12-24-27(15-18)13-16-7-8-19(28-5-2)20(9-16)29-6-3/h7-9,11-12,14-15H,4-6,10,13H2,1-3H3,(H2,22,25,30) |
| InChIKey | WAQZOQJQHMIIIC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|