C12H18N6S — CID 19445833
1-ethyl-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445833) has the molecular formula C12H18N6S and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-ethyl-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-ethyl-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445833 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-ethyl-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCNC(=S)Nc1cnn(Cc2cnn(CC)c2)c1 |
| InChI | InChI=1S/C12H18N6S/c1-3-13-12(19)16-11-6-15-18(9-11)8-10-5-14-17(4-2)7-10/h5-7,9H,3-4,8H2,1-2H3,(H2,13,16,19) |
| InChIKey | UUAUCKZRSPNSNG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|