C9H16N4OS — CID 115590262
1-ethyl-3-[1-(2-methoxyethyl)pyrazol-4-yl]thiourea (PubChem CID 115590262) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 1-ethyl-3-[1-(2-methoxyethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-ethyl-3-[1-(2-methoxyethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 115590262 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-ethyl-3-[1-(2-methoxyethyl)pyrazol-4-yl]thiourea |
| SMILES | CCNC(=S)Nc1cnn(CCOC)c1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-10-9(15)12-8-6-11-13(7-8)4-5-14-2/h6-7H,3-5H2,1-2H3,(H2,10,12,15) |
| InChIKey | KJPPKBQCBZGAAS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|