C13H15N3O4 — CID 103749044
2,6-dihydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]benzamide (PubChem CID 103749044) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2,6-dihydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]benzamide.
| Compound Name | 2,6-dihydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 103749044 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2,6-dihydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]benzamide |
| SMILES | COCCn1cc(NC(=O)c2c(O)cccc2O)cn1 |
| InChI | InChI=1S/C13H15N3O4/c1-20-6-5-16-8-9(7-14-16)15-13(19)12-10(17)3-2-4-11(12)18/h2-4,7-8,17-18H,5-6H2,1H3,(H,15,19) |
| InChIKey | OIIQZWDSGPKACA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |