C15H19N5O4 — CID 47050574
3-[1-(2-methoxyethyl)pyrazol-4-yl]-1-methyl-1-[(3-nitrophenyl)methyl]urea (PubChem CID 47050574) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-[1-(2-methoxyethyl)pyrazol-4-yl]-1-methyl-1-[(3-nitrophenyl)methyl]urea.
| Compound Name | 3-[1-(2-methoxyethyl)pyrazol-4-yl]-1-methyl-1-[(3-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 47050574 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[1-(2-methoxyethyl)pyrazol-4-yl]-1-methyl-1-[(3-nitrophenyl)methyl]urea |
| SMILES | COCCn1cc(NC(=O)N(C)Cc2cccc([N+](=O)[O-])c2)cn1 |
| InChI | InChI=1S/C15H19N5O4/c1-18(10-12-4-3-5-14(8-12)20(22)23)15(21)17-13-9-16-19(11-13)6-7-24-2/h3-5,8-9,11H,6-7,10H2,1-2H3,(H,17,21) |
| InChIKey | OKCTVLNIYRUEHU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|