C10H15N3O2 — CID 78968035
N-[1-(2-methoxyethyl)pyrazol-4-yl]but-2-enamide (PubChem CID 78968035) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)pyrazol-4-yl]but-2-enamide.
| Compound Name | N-[1-(2-methoxyethyl)pyrazol-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 78968035 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[1-(2-methoxyethyl)pyrazol-4-yl]but-2-enamide |
| SMILES | CC=CC(=O)Nc1cnn(CCOC)c1 |
| InChI | InChI=1S/C10H15N3O2/c1-3-4-10(14)12-9-7-11-13(8-9)5-6-15-2/h3-4,7-8H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | XPIJVZBNKXBYGN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|