C11H21ClN4O2 — CID 119292257
2-amino-N-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methylbutanamide;hydrochloride (PubChem CID 119292257) has the molecular formula C11H21ClN4O2 and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-amino-N-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119292257 |
| Molecular Formula | C11H21ClN4O2 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-amino-N-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methylbutanamide;hydrochloride |
| SMILES | COCCn1cc(NC(=O)C(N)C(C)C)cn1.Cl |
| InChI | InChI=1S/C11H20N4O2.ClH/c1-8(2)10(12)11(16)14-9-6-13-15(7-9)4-5-17-3;/h6-8,10H,4-5,12H2,1-3H3,(H,14,16);1H |
| InChIKey | PFKZADZEOLZLQK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |