C14H25N5O3 — CID 119800898
(2S)-2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-3,3-dimethylbutanamide (PubChem CID 119800898) has the molecular formula C14H25N5O3 and a molecular weight of 311.39 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119800898 |
| Molecular Formula | C14H25N5O3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (2S)-2-amino-N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-3,3-dimethylbutanamide |
| SMILES | COCCNC(=O)Cn1cc(NC(=O)[C@@H](N)C(C)(C)C)cn1 |
| InChI | InChI=1S/C14H25N5O3/c1-14(2,3)12(15)13(21)18-10-7-17-19(8-10)9-11(20)16-5-6-22-4/h7-8,12H,5-6,9,15H2,1-4H3,(H,16,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | UVGAIMFAOCXMLD-GFCCVEGCSA-N |
| XLogP | -0.04 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|