C9H15N3O2 — CID 19526602
N-(2-methoxyethyl)-2-(4-methylpyrazol-1-yl)acetamide (PubChem CID 19526602) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(4-methylpyrazol-1-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(4-methylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19526602 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(2-methoxyethyl)-2-(4-methylpyrazol-1-yl)acetamide |
| SMILES | COCCNC(=O)Cn1cc(C)cn1 |
| InChI | InChI=1S/C9H15N3O2/c1-8-5-11-12(6-8)7-9(13)10-3-4-14-2/h5-6H,3-4,7H2,1-2H3,(H,10,13) |
| InChIKey | CCYVJIUQXCHICY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|