C10H15N3O4 — CID 19622294
1-[2-(3-methoxypropylamino)-2-oxoethyl]pyrazole-4-carboxylic acid (PubChem CID 19622294) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-[2-(3-methoxypropylamino)-2-oxoethyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[2-(3-methoxypropylamino)-2-oxoethyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19622294 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-[2-(3-methoxypropylamino)-2-oxoethyl]pyrazole-4-carboxylic acid |
| SMILES | COCCCNC(=O)Cn1cc(C(=O)O)cn1 |
| InChI | InChI=1S/C10H15N3O4/c1-17-4-2-3-11-9(14)7-13-6-8(5-12-13)10(15)16/h5-6H,2-4,7H2,1H3,(H,11,14)(H,15,16) |
| InChIKey | QDVJRZBUSCQGDI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|