C11H19N5O4 — CID 116735160
2-amino-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]triazol-4-yl]propanoic acid (PubChem CID 116735160) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-amino-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]triazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 116735160 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-amino-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]triazol-4-yl]propanoic acid |
| SMILES | COCCCNC(=O)Cn1cc(CC(N)C(=O)O)nn1 |
| InChI | InChI=1S/C11H19N5O4/c1-20-4-2-3-13-10(17)7-16-6-8(14-15-16)5-9(12)11(18)19/h6,9H,2-5,7,12H2,1H3,(H,13,17)(H,18,19) |
| InChIKey | QGQWUSCYVHCTER-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|