C11H21N5O3 — CID 115459604
2-[4-(aminomethyl)triazol-1-yl]-N-[3-(2-methoxyethoxy)propyl]acetamide (PubChem CID 115459604) has the molecular formula C11H21N5O3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-[3-(2-methoxyethoxy)propyl]acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[3-(2-methoxyethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 115459604 |
| Molecular Formula | C11H21N5O3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[3-(2-methoxyethoxy)propyl]acetamide |
| SMILES | COCCOCCCNC(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C11H21N5O3/c1-18-5-6-19-4-2-3-13-11(17)9-16-8-10(7-12)14-15-16/h8H,2-7,9,12H2,1H3,(H,13,17) |
| InChIKey | ZZCFFOVBMZAVAS-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|