C12H20N6O2 — CID 115460101
4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-cyclopropylbutanamide (PubChem CID 115460101) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 115460101 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-N-cyclopropylbutanamide |
| SMILES | NCc1cn(CC(=O)NCCCC(=O)NC2CC2)nn1 |
| InChI | InChI=1S/C12H20N6O2/c13-6-10-7-18(17-16-10)8-12(20)14-5-1-2-11(19)15-9-3-4-9/h7,9H,1-6,8,13H2,(H,14,20)(H,15,19) |
| InChIKey | XHYPOSXGVFKHOZ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|