C12H21N7O2 — CID 115459189
2-[4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]piperidin-1-yl]acetamide (PubChem CID 115459189) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-[4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 115459189 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[4-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]piperidin-1-yl]acetamide |
| SMILES | NCc1cn(CC(=O)NC2CCN(CC(N)=O)CC2)nn1 |
| InChI | InChI=1S/C12H21N7O2/c13-5-10-6-19(17-16-10)8-12(21)15-9-1-3-18(4-2-9)7-11(14)20/h6,9H,1-5,7-8,13H2,(H2,14,20)(H,15,21) |
| InChIKey | TZTJIEXVUAIELN-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |