C9H16ClN3O2 — CID 43425925
2-[4-[(2-chloroacetyl)amino]piperidin-1-yl]acetamide (PubChem CID 43425925) has the molecular formula C9H16ClN3O2 and a molecular weight of 233.70 g/mol. Its IUPAC name is 2-[4-[(2-chloroacetyl)amino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(2-chloroacetyl)amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 43425925 |
| Molecular Formula | C9H16ClN3O2 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-[4-[(2-chloroacetyl)amino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NC(=O)CCl)CC1 |
| InChI | InChI=1S/C9H16ClN3O2/c10-5-9(15)12-7-1-3-13(4-2-7)6-8(11)14/h7H,1-6H2,(H2,11,14)(H,12,15) |
| InChIKey | FMYPWISYKYWNQT-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|