C7H12ClN3O2 — CID 130678398
3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxamide (PubChem CID 130678398) has the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxamide.
| Compound Name | 3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 130678398 |
| Molecular Formula | C7H12ClN3O2 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NC(=O)CCl)C1 |
| InChI | InChI=1S/C7H12ClN3O2/c8-3-6(12)10-5-1-2-11(4-5)7(9)13/h5H,1-4H2,(H2,9,13)(H,10,12) |
| InChIKey | HAWUKDGLJBJBQP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|