C8H16N4O2 — CID 131187067
3-(dimethylcarbamoylamino)pyrrolidine-1-carboxamide (PubChem CID 131187067) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(dimethylcarbamoylamino)pyrrolidine-1-carboxamide.
| Compound Name | 3-(dimethylcarbamoylamino)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 131187067 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-(dimethylcarbamoylamino)pyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)NC1CCN(C(N)=O)C1 |
| InChI | InChI=1S/C8H16N4O2/c1-11(2)8(14)10-6-3-4-12(5-6)7(9)13/h6H,3-5H2,1-2H3,(H2,9,13)(H,10,14) |
| InChIKey | PVKIVHVCLQVZIM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |