C13H19N3O — CID 110459954
1,1-dimethyl-3-(1-phenylpyrrolidin-3-yl)urea (PubChem CID 110459954) has the molecular formula C13H19N3O and a molecular weight of 233.32 g/mol. Its IUPAC name is 1,1-dimethyl-3-(1-phenylpyrrolidin-3-yl)urea.
| Compound Name | 1,1-dimethyl-3-(1-phenylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 110459954 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1,1-dimethyl-3-(1-phenylpyrrolidin-3-yl)urea |
| SMILES | CN(C)C(=O)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C13H19N3O/c1-15(2)13(17)14-11-8-9-16(10-11)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,14,17) |
| InChIKey | JAZNAAZQXMQHHZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |