C25H40N2O — CID 167597146
ethane;2-(4-methylphenyl)-N-(1-phenylpyrrolidin-3-yl)acetamide (PubChem CID 167597146) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is ethane;2-(4-methylphenyl)-N-(1-phenylpyrrolidin-3-yl)acetamide.
| Compound Name | ethane;2-(4-methylphenyl)-N-(1-phenylpyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 167597146 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | ethane;2-(4-methylphenyl)-N-(1-phenylpyrrolidin-3-yl)acetamide |
| SMILES | CC.CC.CC.Cc1ccc(CC(=O)NC2CCN(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H22N2O.3C2H6/c1-15-7-9-16(10-8-15)13-19(22)20-17-11-12-21(14-17)18-5-3-2-4-6-18;3*1-2/h2-10,17H,11-14H2,1H3,(H,20,22);3*1-2H3 |
| InChIKey | JFMNSHVLWNAGQS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |