C16H25N5O — CID 119149781
N,N-dimethyl-2-[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]acetamide (PubChem CID 119149781) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 119149781 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N,N-dimethyl-2-[[N'-methyl-N-(1-phenylpyrrolidin-3-yl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)C)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C16H25N5O/c1-17-16(18-11-15(22)20(2)3)19-13-9-10-21(12-13)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | UDAKPDKMSGZTCO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|