C15H20N4 — CID 111910545
2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-prop-2-ynylguanidine (PubChem CID 111910545) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-prop-2-ynylguanidine.
| Compound Name | 2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111910545 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C15H20N4/c1-3-10-17-15(16-2)18-13-9-11-19(12-13)14-7-5-4-6-8-14/h1,4-8,13H,9-12H2,2H3,(H2,16,17,18) |
| InChIKey | MPNFXPREPFACRS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|