C16H23N3O2 — CID 108566970
1,1-dimethyl-3-[1-(2-methylbenzoyl)piperidin-4-yl]urea (PubChem CID 108566970) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1,1-dimethyl-3-[1-(2-methylbenzoyl)piperidin-4-yl]urea.
| Compound Name | 1,1-dimethyl-3-[1-(2-methylbenzoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 108566970 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1,1-dimethyl-3-[1-(2-methylbenzoyl)piperidin-4-yl]urea |
| SMILES | Cc1ccccc1C(=O)N1CCC(NC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C16H23N3O2/c1-12-6-4-5-7-14(12)15(20)19-10-8-13(9-11-19)17-16(21)18(2)3/h4-7,13H,8-11H2,1-3H3,(H,17,21) |
| InChIKey | UJNIGPZEZILFRT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |