C7H11F2N3O2 — CID 131036642
3-[(2,2-difluoroacetyl)amino]pyrrolidine-1-carboxamide (PubChem CID 131036642) has the molecular formula C7H11F2N3O2 and a molecular weight of 207.18 g/mol. Its IUPAC name is 3-[(2,2-difluoroacetyl)amino]pyrrolidine-1-carboxamide.
| Compound Name | 3-[(2,2-difluoroacetyl)amino]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 131036642 |
| Molecular Formula | C7H11F2N3O2 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-[(2,2-difluoroacetyl)amino]pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NC(=O)C(F)F)C1 |
| InChI | InChI=1S/C7H11F2N3O2/c8-5(9)6(13)11-4-1-2-12(3-4)7(10)14/h4-5H,1-3H2,(H2,10,14)(H,11,13) |
| InChIKey | CBNMTSDFKCALAW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |