C11H16ClF3N2O2 — CID 154856774
2-chloro-N-[(3R)-1-(4,4,4-trifluorobutanoyl)piperidin-3-yl]acetamide (PubChem CID 154856774) has the molecular formula C11H16ClF3N2O2 and a molecular weight of 300.71 g/mol. Its IUPAC name is 2-chloro-N-[(3R)-1-(4,4,4-trifluorobutanoyl)piperidin-3-yl]acetamide.
| Compound Name | 2-chloro-N-[(3R)-1-(4,4,4-trifluorobutanoyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 154856774 |
| Molecular Formula | C11H16ClF3N2O2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-chloro-N-[(3R)-1-(4,4,4-trifluorobutanoyl)piperidin-3-yl]acetamide |
| SMILES | O=C(CCl)N[C@@H]1CCCN(C(=O)CCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H16ClF3N2O2/c12-6-9(18)16-8-2-1-5-17(7-8)10(19)3-4-11(13,14)15/h8H,1-7H2,(H,16,18)/t8-/m1/s1 |
| InChIKey | UJGHLYPTVMWFLW-MRVPVSSYSA-N |
| XLogP | 1.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|