C7H11ClN2O3 — CID 126666154
(3S)-3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxylic acid (PubChem CID 126666154) has the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. Its IUPAC name is (3S)-3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126666154 |
| Molecular Formula | C7H11ClN2O3 |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (3S)-3-[(2-chloroacetyl)amino]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(CCl)N[C@H]1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C7H11ClN2O3/c8-3-6(11)9-5-1-2-10(4-5)7(12)13/h5H,1-4H2,(H,9,11)(H,12,13)/t5-/m0/s1 |
| InChIKey | KZJWHCPLTCKOLG-YFKPBYRVSA-N |
| XLogP | 0.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|