C8H13ClN2O4 — CID 139510459
(3S,4S)-3-[(2-chloroacetyl)amino]-4-hydroxypiperidine-1-carboxylic acid (PubChem CID 139510459) has the molecular formula C8H13ClN2O4 and a molecular weight of 236.65 g/mol. Its IUPAC name is (3S,4S)-3-[(2-chloroacetyl)amino]-4-hydroxypiperidine-1-carboxylic acid.
| Compound Name | (3S,4S)-3-[(2-chloroacetyl)amino]-4-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 139510459 |
| Molecular Formula | C8H13ClN2O4 |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (3S,4S)-3-[(2-chloroacetyl)amino]-4-hydroxypiperidine-1-carboxylic acid |
| SMILES | O=C(CCl)N[C@H]1CN(C(=O)O)CC[C@@H]1O |
| InChI | InChI=1S/C8H13ClN2O4/c9-3-7(13)10-5-4-11(8(14)15)2-1-6(5)12/h5-6,12H,1-4H2,(H,10,13)(H,14,15)/t5-,6-/m0/s1 |
| InChIKey | OBCAGOSWABABQP-WDSKDSINSA-N |
| XLogP | -0.55 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|