C10H19N3O4 — CID 79346332
2-hydroxyethyl N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]carbamate (PubChem CID 79346332) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-hydroxyethyl N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]carbamate.
| Compound Name | 2-hydroxyethyl N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 79346332 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-hydroxyethyl N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]carbamate |
| SMILES | NC(=O)CN1CCC(NC(=O)OCCO)CC1 |
| InChI | InChI=1S/C10H19N3O4/c11-9(15)7-13-3-1-8(2-4-13)12-10(16)17-6-5-14/h8,14H,1-7H2,(H2,11,15)(H,12,16) |
| InChIKey | SMTDLBTUUGUOCU-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |