C16H32N2O5 — CID 156865630
tert-butyl N-[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperidin-4-yl]carbamate (PubChem CID 156865630) has the molecular formula C16H32N2O5 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 156865630 |
| Molecular Formula | C16H32N2O5 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | tert-butyl N-[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCOCCOCCO)CC1 |
| InChI | InChI=1S/C16H32N2O5/c1-16(2,3)23-15(20)17-14-4-6-18(7-5-14)8-10-21-12-13-22-11-9-19/h14,19H,4-13H2,1-3H3,(H,17,20) |
| InChIKey | CCAWGCPAWRCEEJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|