C21H34N2O6S — CID 175192025
4-methyl-2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethyl]benzenesulfonic acid (PubChem CID 175192025) has the molecular formula C21H34N2O6S and a molecular weight of 442.58 g/mol. Its IUPAC name is 4-methyl-2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175192025 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-methyl-2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCCN2CCC(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H34N2O6S/c1-16-5-6-19(30(25,26)27)17(15-16)9-13-28-14-12-23-10-7-18(8-11-23)22-20(24)29-21(2,3)4/h5-6,15,18H,7-14H2,1-4H3,(H,22,24)(H,25,26,27) |
| InChIKey | NUQKQFHKPNKPGK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|