C17H24F2N2O2 — CID 22182435
tert-butyl N-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]carbamate (PubChem CID 22182435) has the molecular formula C17H24F2N2O2 and a molecular weight of 326.39 g/mol. Its IUPAC name is tert-butyl N-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 22182435 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl N-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C17H24F2N2O2/c1-17(2,3)23-16(22)20-15-4-6-21(7-5-15)11-12-8-13(18)10-14(19)9-12/h8-10,15H,4-7,11H2,1-3H3,(H,20,22) |
| InChIKey | JUFASUSPQFHDEK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |