C18H24BrF3N2O2 — CID 158272872
tert-butyl N-[1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate (PubChem CID 158272872) has the molecular formula C18H24BrF3N2O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 158272872 |
| Molecular Formula | C18H24BrF3N2O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | tert-butyl N-[1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2cc(Br)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H24BrF3N2O2/c1-17(2,3)26-16(25)23-15-4-6-24(7-5-15)11-12-8-13(18(20,21)22)10-14(19)9-12/h8-10,15H,4-7,11H2,1-3H3,(H,23,25) |
| InChIKey | GJGJNMLNYOOEKT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |