C19H26BrF3N2O3 — CID 170855026
tert-butyl N-[1-[2-[2-bromo-5-(trifluoromethyl)phenoxy]ethyl]piperidin-4-yl]carbamate (PubChem CID 170855026) has the molecular formula C19H26BrF3N2O3 and a molecular weight of 467.33 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[2-bromo-5-(trifluoromethyl)phenoxy]ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[2-bromo-5-(trifluoromethyl)phenoxy]ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170855026 |
| Molecular Formula | C19H26BrF3N2O3 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | tert-butyl N-[1-[2-[2-bromo-5-(trifluoromethyl)phenoxy]ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCOc2cc(C(F)(F)F)ccc2Br)CC1 |
| InChI | InChI=1S/C19H26BrF3N2O3/c1-18(2,3)28-17(26)24-14-6-8-25(9-7-14)10-11-27-16-12-13(19(21,22)23)4-5-15(16)20/h4-5,12,14H,6-11H2,1-3H3,(H,24,26) |
| InChIKey | XDGZHSNHJKQNDQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |