C19H26BrF3N2O4 — CID 170855117
tert-butyl N-[1-[2-[4-bromo-3-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]carbamate (PubChem CID 170855117) has the molecular formula C19H26BrF3N2O4 and a molecular weight of 483.33 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[4-bromo-3-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[4-bromo-3-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170855117 |
| Molecular Formula | C19H26BrF3N2O4 |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | tert-butyl N-[1-[2-[4-bromo-3-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCOc2ccc(Br)c(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H26BrF3N2O4/c1-18(2,3)29-17(26)24-13-6-8-25(9-7-13)10-11-27-14-4-5-15(20)16(12-14)28-19(21,22)23/h4-5,12-13H,6-11H2,1-3H3,(H,24,26) |
| InChIKey | GZFBOHKSQLJLQZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |