C24H29N3O3 — CID 10136089
tert-butyl N-[(3S)-1-[2-[4-(4-cyanophenyl)phenoxy]ethyl]pyrrolidin-3-yl]carbamate (PubChem CID 10136089) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-[4-(4-cyanophenyl)phenoxy]ethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-[4-(4-cyanophenyl)phenoxy]ethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 10136089 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-[4-(4-cyanophenyl)phenoxy]ethyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(CCOc2ccc(-c3ccc(C#N)cc3)cc2)C1 |
| InChI | InChI=1S/C24H29N3O3/c1-24(2,3)30-23(28)26-21-12-13-27(17-21)14-15-29-22-10-8-20(9-11-22)19-6-4-18(16-25)5-7-19/h4-11,21H,12-15,17H2,1-3H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | PSFGCTNSCSNFCU-NRFANRHFSA-N |
| XLogP | 4.20 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |