C28H36N4O4 — CID 91439615
tert-butyl N-[(2R)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 91439615) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91439615 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCN(CCCOc2ccc(-c3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H36N4O4/c1-21(30-27(34)36-28(2,3)4)26(33)32-17-15-31(16-18-32)14-5-19-35-25-12-10-24(11-13-25)23-8-6-22(20-29)7-9-23/h6-13,21H,5,14-19H2,1-4H3,(H,30,34)/t21-/m1/s1 |
| InChIKey | FRCOKXPBXFJNAU-OAQYLSRUSA-N |
| XLogP | 4.05 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|