C25H29N4O4- — CID 20582913
N-[(2S)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 20582913) has the molecular formula C25H29N4O4- and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[(2S)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | N-[(2S)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 20582913 |
| Molecular Formula | C25H29N4O4- |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[(2S)-1-[4-[3-[4-(4-cyanophenyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)[O-])C(=O)N1CCCN(CCCOc2ccc(-c3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H30N4O4/c1-19(27-25(31)32)24(30)29-14-2-12-28(15-16-29)13-3-17-33-23-10-8-22(9-11-23)21-6-4-20(18-26)5-7-21/h4-11,19,27H,2-3,12-17H2,1H3,(H,31,32)/p-1/t19-/m0/s1 |
| InChIKey | FBEZRHDIYOTSCS-IBGZPJMESA-M |
| XLogP | 1.85 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|