C18H25FN4O2 — CID 70035526
4-[3-[4-[(2R)-2-aminopropanoyl]-1,4-diazepan-1-yl]propoxy]-2-fluorobenzonitrile (PubChem CID 70035526) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-[3-[4-[(2R)-2-aminopropanoyl]-1,4-diazepan-1-yl]propoxy]-2-fluorobenzonitrile.
| Compound Name | 4-[3-[4-[(2R)-2-aminopropanoyl]-1,4-diazepan-1-yl]propoxy]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 70035526 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-[3-[4-[(2R)-2-aminopropanoyl]-1,4-diazepan-1-yl]propoxy]-2-fluorobenzonitrile |
| SMILES | C[C@@H](N)C(=O)N1CCCN(CCCOc2ccc(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C18H25FN4O2/c1-14(21)18(24)23-8-2-6-22(9-10-23)7-3-11-25-16-5-4-15(13-20)17(19)12-16/h4-5,12,14H,2-3,6-11,21H2,1H3/t14-/m1/s1 |
| InChIKey | IFHVKACQDMEXPR-CQSZACIVSA-N |
| XLogP | 1.35 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|